About [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate
[(3E)-4,6-dimethylocta-3,7-dienyl] propanoate (PubChem CID 101283482) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate.
Molecular Properties
| Compound Name | [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate |
| PubChem CID | 101283482 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate |
| SMILES | C=CC(C)C/C(C)=C/CCOC(=O)CC |
| InChI | InChI=1S/C13H22O2/c1-5-11(3)10-12(4)8-7-9-15-13(14)6-2/h5,8,11H,1,6-7,9-10H2,2-4H3/b12-8+ |
| InChIKey | YDPWPCNXZUQZCO-XYOKQWHBSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate?
The IUPAC name of [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate (CID 101283482) is [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate.
What is the SMILES notation for [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate?
The canonical SMILES for [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate is C=CC(C)C/C(C)=C/CCOC(=O)CC.
What is the InChIKey of [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate?
The InChIKey is YDPWPCNXZUQZCO-XYOKQWHBSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-11(3)10-12(4)8-7-9-15-13(14)6-2/h5,8,11H,1,6-7,9-10H2,2-4H3/b12-8+.
What are the key properties of [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate?
[(3E)-4,6-dimethylocta-3,7-dienyl] propanoate has a molecular weight of 210.32 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4,6-dimethylocta-3,7-dienyl] propanoate is sourced from PubChem (CID 101283482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).