C22H44CaN2O8S2 — CID 101283669
calcium;3-(octanoylamino)propane-1-sulfonic acid;N-(3-sulfonatopropyl)octanimidate (PubChem CID 101283669) has the molecular formula C22H44CaN2O8S2 and a molecular weight of 568.81 g/mol. Its IUPAC name is calcium;3-(octanoylamino)propane-1-sulfonic acid;N-(3-sulfonatopropyl)octanimidate.
| Compound Name | calcium;3-(octanoylamino)propane-1-sulfonic acid;N-(3-sulfonatopropyl)octanimidate |
|---|---|
| PubChem CID | 101283669 |
| Molecular Formula | C22H44CaN2O8S2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | calcium;3-(octanoylamino)propane-1-sulfonic acid;N-(3-sulfonatopropyl)octanimidate |
| SMILES | CCCCCCC/C([O-])=N/CCCS(=O)(=O)[O-].CCCCCCCC(=O)NCCCS(=O)(=O)O.[Ca+2] |
| InChI | InChI=1S/2C11H23NO4S.Ca/c2*1-2-3-4-5-6-8-11(13)12-9-7-10-17(14,15)16;/h2*2-10H2,1H3,(H,12,13)(H,14,15,16);/q;;+2/p-2 |
| InChIKey | JHRRUJYBIFTGHI-UHFFFAOYSA-L |
| XLogP | 2.40 |
| TPSA | 176.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|