C25H28FN7O4 — CID 10128386
N-(3-fluorophenyl)-2-[3-[[7-[3-(2-hydroxyethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide (PubChem CID 10128386) has the molecular formula C25H28FN7O4 and a molecular weight of 509.54 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-[[7-[3-(2-hydroxyethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[3-[[7-[3-(2-hydroxyethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 10128386 |
| Molecular Formula | C25H28FN7O4 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-[[7-[3-(2-hydroxyethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
| SMILES | COc1cc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2cc1OCCCNCCO |
| InChI | InChI=1S/C25H28FN7O4/c1-36-21-13-19-20(14-22(21)37-9-3-6-27-7-8-34)28-15-29-25(19)31-23-11-18(32-33-23)12-24(35)30-17-5-2-4-16(26)10-17/h2,4-5,10-11,13-15,27,34H,3,6-9,12H2,1H3,(H,30,35)(H2,28,29,31,32,33) |
| InChIKey | KSAUSYLGKMZHPT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|