C12H20NNaO4 — CID 101285023
sodium 2-[carboxymethyl-[(E)-oct-3-enyl]amino]acetate (PubChem CID 101285023) has the molecular formula C12H20NNaO4 and a molecular weight of 265.28 g/mol. Its IUPAC name is sodium 2-[carboxymethyl-[(E)-oct-3-enyl]amino]acetate.
| Compound Name | sodium 2-[carboxymethyl-[(E)-oct-3-enyl]amino]acetate |
|---|---|
| PubChem CID | 101285023 |
| Molecular Formula | C12H20NNaO4 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | sodium 2-[carboxymethyl-[(E)-oct-3-enyl]amino]acetate |
| SMILES | CCCC/C=C/CCN(CC(=O)[O-])CC(=O)O.[Na+] |
| InChI | InChI=1S/C12H21NO4.Na/c1-2-3-4-5-6-7-8-13(9-11(14)15)10-12(16)17;/h5-6H,2-4,7-10H2,1H3,(H,14,15)(H,16,17);/q;+1/p-1/b6-5+; |
| InChIKey | NOKMWKPSZUJDJG-IPZCTEOASA-M |
| XLogP | -2.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|