C16H33N5O5 — CID 101285690
2-amino-N-[(1S,2R,3S,4R)-4-amino-3-[(2R,3R,6S)-3-amino-6-(aminomethyl)oxan-2-yl]oxy-2-hydroxy-6-methoxycyclohexyl]-N-methylacetamide (PubChem CID 101285690) has the molecular formula C16H33N5O5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-amino-N-[(1S,2R,3S,4R)-4-amino-3-[(2R,3R,6S)-3-amino-6-(aminomethyl)oxan-2-yl]oxy-2-hydroxy-6-methoxycyclohexyl]-N-methylacetamide.
| Compound Name | 2-amino-N-[(1S,2R,3S,4R)-4-amino-3-[(2R,3R,6S)-3-amino-6-(aminomethyl)oxan-2-yl]oxy-2-hydroxy-6-methoxycyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 101285690 |
| Molecular Formula | C16H33N5O5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 2-amino-N-[(1S,2R,3S,4R)-4-amino-3-[(2R,3R,6S)-3-amino-6-(aminomethyl)oxan-2-yl]oxy-2-hydroxy-6-methoxycyclohexyl]-N-methylacetamide |
| SMILES | COC1C[C@@H](N)[C@H](O[C@H]2O[C@H](CN)CC[C@H]2N)[C@H](O)[C@@H]1N(C)C(=O)CN |
| InChI | InChI=1S/C16H33N5O5/c1-21(12(22)7-18)13-11(24-2)5-10(20)15(14(13)23)26-16-9(19)4-3-8(6-17)25-16/h8-11,13-16,23H,3-7,17-20H2,1-2H3/t8-,9+,10+,11?,13+,14+,15-,16+/m0/s1 |
| InChIKey | JCMGTIXJTDLOQI-PJXVJYNDSA-N |
| XLogP | -2.94 |
| TPSA | 172.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |