C18H29NOS — CID 101286008
5,5,7,7-tetramethylspiro[6,7a-dihydropyrrolo[1,2-b][1,4,2]oxathiazole-2,2'-adamantane] (PubChem CID 101286008) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is 5,5,7,7-tetramethylspiro[6,7a-dihydropyrrolo[1,2-b][1,4,2]oxathiazole-2,2'-adamantane].
| Compound Name | 5,5,7,7-tetramethylspiro[6,7a-dihydropyrrolo[1,2-b][1,4,2]oxathiazole-2,2'-adamantane] |
|---|---|
| PubChem CID | 101286008 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 5,5,7,7-tetramethylspiro[6,7a-dihydropyrrolo[1,2-b][1,4,2]oxathiazole-2,2'-adamantane] |
| SMILES | CC1(C)CC(C)(C)N2OC3(SC21)C1CC2CC(C1)CC3C2 |
| InChI | InChI=1S/C18H29NOS/c1-16(2)10-17(3,4)19-15(16)21-18(20-19)13-6-11-5-12(8-13)9-14(18)7-11/h11-15H,5-10H2,1-4H3 |
| InChIKey | MWYLWVGTATWLEG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |