C23H42O13 — CID 101286051
(2R,3S,4R)-4-[(2S,3R,4S,5R)-3,5-dimethoxy-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trimethoxypentanal (PubChem CID 101286051) has the molecular formula C23H42O13 and a molecular weight of 526.58 g/mol. Its IUPAC name is (2R,3S,4R)-4-[(2S,3R,4S,5R)-3,5-dimethoxy-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trimethoxypentanal.
| Compound Name | (2R,3S,4R)-4-[(2S,3R,4S,5R)-3,5-dimethoxy-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trimethoxypentanal |
|---|---|
| PubChem CID | 101286051 |
| Molecular Formula | C23H42O13 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | (2R,3S,4R)-4-[(2S,3R,4S,5R)-3,5-dimethoxy-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trimethoxypentanal |
| SMILES | COC[C@@H](O[C@@H]1OC[C@@H](OC)[C@H](O[C@@H]2OC[C@@H](OC)[C@H](OC)[C@H]2OC)[C@H]1OC)[C@H](OC)[C@H](C=O)OC |
| InChI | InChI=1S/C23H42O13/c1-25-10-16(17(29-5)13(9-24)26-2)35-22-21(32-8)19(15(28-4)12-33-22)36-23-20(31-7)18(30-6)14(27-3)11-34-23/h9,13-23H,10-12H2,1-8H3/t13-,14+,15+,16+,17+,18-,19-,20+,21+,22-,23-/m0/s1 |
| InChIKey | RFTPMDGKTJFODW-YJFQYJGHSA-N |
| XLogP | -0.58 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|