C9H16NO3+ — CID 101286187
(1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol (PubChem CID 101286187) has the molecular formula C9H16NO3+ and a molecular weight of 186.23 g/mol. Its IUPAC name is (1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol.
| Compound Name | (1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol |
|---|---|
| PubChem CID | 101286187 |
| Molecular Formula | C9H16NO3+ |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (1R,4R,8S)-7-(hydroxymethyl)-4-methyl-1,2,3,5-tetrahydropyrrolizin-4-ium-1,8-diol |
| SMILES | C[N@@+]12CC=C(CO)[C@]1(O)[C@H](O)CC2 |
| InChI | InChI=1S/C9H16NO3/c1-10-4-2-7(6-11)9(10,13)8(12)3-5-10/h2,8,11-13H,3-6H2,1H3/q+1/t8-,9+,10+/m1/s1 |
| InChIKey | MHCDHCVYFDHGEB-UTLUCORTSA-N |
| XLogP | -1.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|