C26H34O4 — CID 101286250
(4S,7E,11E,15E)-19-hydroxy-3,3,7,11,15-pentamethyl-2-oxatricyclo[16.3.1.04,21]docosa-1(21),7,11,15,18-pentaene-20,22-dione (PubChem CID 101286250) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (4S,7E,11E,15E)-19-hydroxy-3,3,7,11,15-pentamethyl-2-oxatricyclo[16.3.1.04,21]docosa-1(21),7,11,15,18-pentaene-20,22-dione.
| Compound Name | (4S,7E,11E,15E)-19-hydroxy-3,3,7,11,15-pentamethyl-2-oxatricyclo[16.3.1.04,21]docosa-1(21),7,11,15,18-pentaene-20,22-dione |
|---|---|
| PubChem CID | 101286250 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (4S,7E,11E,15E)-19-hydroxy-3,3,7,11,15-pentamethyl-2-oxatricyclo[16.3.1.04,21]docosa-1(21),7,11,15,18-pentaene-20,22-dione |
| SMILES | C/C1=C\CC/C(C)=C/CC2=C(O)C(=O)C3=C(OC(C)(C)[C@H]3CC/C(C)=C/CC1)C2=O |
| InChI | InChI=1S/C26H34O4/c1-16-8-6-10-17(2)12-14-19-22(27)24(29)21-20(15-13-18(3)11-7-9-16)26(4,5)30-25(21)23(19)28/h8,11-12,20,27H,6-7,9-10,13-15H2,1-5H3/b16-8+,17-12+,18-11+/t20-/m0/s1 |
| InChIKey | HNZJHYHUUDPPHQ-YAYCPBPMSA-N |
| XLogP | 6.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|