C26H18ClF3N4O3 — CID 10128632
4-[[2-[2-chloro-6-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7a-yl]methyl]benzonitrile (PubChem CID 10128632) has the molecular formula C26H18ClF3N4O3 and a molecular weight of 526.90 g/mol. Its IUPAC name is 4-[[2-[2-chloro-6-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7a-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-[2-chloro-6-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7a-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 10128632 |
| Molecular Formula | C26H18ClF3N4O3 |
| Molecular Weight | 526.90 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 4-[[2-[2-chloro-6-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7a-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CC23CCCN2C(=O)N(c2cc(Cl)nc(-c4ccc(OC(F)(F)F)cc4)c2)C3=O)cc1 |
| InChI | InChI=1S/C26H18ClF3N4O3/c27-22-13-19(12-21(32-22)18-6-8-20(9-7-18)37-26(28,29)30)34-23(35)25(10-1-11-33(25)24(34)36)14-16-2-4-17(15-31)5-3-16/h2-9,12-13H,1,10-11,14H2 |
| InChIKey | AYKIHIPTIGXOKW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 86.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.90 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|