About calcium bis(2-heptylundecyl sulfate)
calcium bis(2-heptylundecyl sulfate) (PubChem CID 101287309) has the molecular formula C36H74CaO8S2
and a molecular weight of 739.19 g/mol. Its IUPAC name is calcium bis(2-heptylundecyl sulfate).
Molecular Properties
| Compound Name | calcium bis(2-heptylundecyl sulfate) |
| PubChem CID | 101287309 |
| Molecular Formula | C36H74CaO8S2 |
| Molecular Weight | 739.19 g/mol |
| Exact Mass | 738.45 |
| IUPAC Name | calcium bis(2-heptylundecyl sulfate) |
| SMILES | CCCCCCCCCC(CCCCCCC)COS(=O)(=O)[O-].CCCCCCCCCC(CCCCCCC)COS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C18H38O4S.Ca/c2*1-3-5-7-9-10-12-14-16-18(17-22-23(19,20)21)15-13-11-8-6-4-2;/h2*18H,3-17H2,1-2H3,(H,19,20,21);/q;;+2/p-2 |
| InChIKey | XLMFFPKBJAPGDF-UHFFFAOYSA-L |
| XLogP | 10.78 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 739.19 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(2-heptylundecyl sulfate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2-heptylundecyl sulfate)?
The IUPAC name of calcium bis(2-heptylundecyl sulfate) (CID 101287309) is calcium bis(2-heptylundecyl sulfate).
What is the SMILES notation for calcium bis(2-heptylundecyl sulfate)?
The canonical SMILES for calcium bis(2-heptylundecyl sulfate) is CCCCCCCCCC(CCCCCCC)COS(=O)(=O)[O-].CCCCCCCCCC(CCCCCCC)COS(=O)(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(2-heptylundecyl sulfate)?
The InChIKey is XLMFFPKBJAPGDF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H38O4S.Ca/c2*1-3-5-7-9-10-12-14-16-18(17-22-23(19,20)21)15-13-11-8-6-4-2;/h2*18H,3-17H2,1-2H3,(H,19,20,21);/q;;+2/p-2.
What are the key properties of calcium bis(2-heptylundecyl sulfate)?
calcium bis(2-heptylundecyl sulfate) has a molecular weight of 739.19 g/mol, XLogP of 10.78, 34 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2-heptylundecyl sulfate) is sourced from PubChem (CID 101287309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).