C29H26N6OS2 — CID 10128744
5-[[(5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-(pyrrolidin-2-ylamino)benzonitrile (PubChem CID 10128744) has the molecular formula C29H26N6OS2 and a molecular weight of 538.70 g/mol. Its IUPAC name is 5-[[(5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-(pyrrolidin-2-ylamino)benzonitrile.
| Compound Name | 5-[[(5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-(pyrrolidin-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 10128744 |
| Molecular Formula | C29H26N6OS2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 5-[[(5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-(pyrrolidin-2-ylamino)benzonitrile |
| SMILES | CN1/C(=C2\S/C(=N\c3ccc(NC4CCCN4)c(C#N)c3)N(Cc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C29H26N6OS2/c1-34-23-10-5-6-11-24(23)37-28(34)26-27(36)35(18-19-8-3-2-4-9-19)29(38-26)32-21-13-14-22(20(16-21)17-30)33-25-12-7-15-31-25/h2-6,8-11,13-14,16,25,31,33H,7,12,15,18H2,1H3/b28-26+,32-29- |
| InChIKey | DBCUKMHKDPOJOF-VIAQMVAKSA-N |
| XLogP | 5.85 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|