C27H29N3O7S — CID 10128755
(2S)-2-[[(E)-[1-(benzenesulfonyl)azetidin-2-yl]iminomethyl]-hydroxyamino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid (PubChem CID 10128755) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is (2S)-2-[[(E)-[1-(benzenesulfonyl)azetidin-2-yl]iminomethyl]-hydroxyamino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(E)-[1-(benzenesulfonyl)azetidin-2-yl]iminomethyl]-hydroxyamino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10128755 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (2S)-2-[[(E)-[1-(benzenesulfonyl)azetidin-2-yl]iminomethyl]-hydroxyamino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
| SMILES | COc1cccc(OC)c1-c1ccc(C[C@@H](C(=O)O)N(O)/C=N/C2CCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O7S/c1-36-23-9-6-10-24(37-2)26(23)20-13-11-19(12-14-20)17-22(27(31)32)29(33)18-28-25-15-16-30(25)38(34,35)21-7-4-3-5-8-21/h3-14,18,22,25,33H,15-17H2,1-2H3,(H,31,32)/b28-18+/t22-,25?/m0/s1 |
| InChIKey | WQXBYGKUMYFEOO-VXZFRQJWSA-N |
| XLogP | 3.51 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|