C9HF7O — CID 101288016
1,3,3,4,5,6,7-heptafluoro-1H-inden-2-one (PubChem CID 101288016) has the molecular formula C9HF7O and a molecular weight of 258.09 g/mol. Its IUPAC name is 1,3,3,4,5,6,7-heptafluoro-1H-inden-2-one.
| Compound Name | 1,3,3,4,5,6,7-heptafluoro-1H-inden-2-one |
|---|---|
| PubChem CID | 101288016 |
| Molecular Formula | C9HF7O |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1,3,3,4,5,6,7-heptafluoro-1H-inden-2-one |
| SMILES | O=C1C(F)c2c(F)c(F)c(F)c(F)c2C1(F)F |
| InChI | InChI=1S/C9HF7O/c10-3-1-2(5(12)7(14)6(3)13)9(15,16)8(17)4(1)11/h4H |
| InChIKey | DSVXFLKCMFABFF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|