C26H36O6 — CID 101288136
18-(hydroxymethyl)-3,6,6,11,11,18,21-heptamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one (PubChem CID 101288136) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 18-(hydroxymethyl)-3,6,6,11,11,18,21-heptamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one.
| Compound Name | 18-(hydroxymethyl)-3,6,6,11,11,18,21-heptamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one |
|---|---|
| PubChem CID | 101288136 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 18-(hydroxymethyl)-3,6,6,11,11,18,21-heptamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-one |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C)OC4C24OC(C)(C)OC14)C1C(CC3C)C1(C)CO |
| InChI | InChI=1S/C26H36O6/c1-13-10-25-14(2)8-17-18(24(17,7)12-27)16(19(25)28)9-15-11-29-22(3,4)31-21(15)26(25)20(13)30-23(5,6)32-26/h9-10,14,16-18,20-21,27H,8,11-12H2,1-7H3 |
| InChIKey | LLTMKPJDDPQUQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|