C30H35ClN6O2 — CID 10128825
5-chloro-N-methyl-N-(2-piperidin-1-ylethyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carboxamide (PubChem CID 10128825) has the molecular formula C30H35ClN6O2 and a molecular weight of 547.10 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-(2-piperidin-1-ylethyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-methyl-N-(2-piperidin-1-ylethyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10128825 |
| Molecular Formula | C30H35ClN6O2 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 5-chloro-N-methyl-N-(2-piperidin-1-ylethyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]pyridine-3-carboxamide |
| SMILES | CN(CCN1CCCCC1)C(=O)c1cnc(NNC(=O)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C30H35ClN6O2/c1-36(17-18-37-15-7-2-8-16-37)29(38)23-19-26(31)28(32-20-23)34-35-30(39)33-27-24-11-5-3-9-21(24)13-14-22-10-4-6-12-25(22)27/h3-6,9-12,19-20,27H,2,7-8,13-18H2,1H3,(H,32,34)(H2,33,35,39) |
| InChIKey | AHHBTEQHPHPZNP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|