C27H29F4N5O3 — CID 10128827
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propoxy]quinazoline (PubChem CID 10128827) has the molecular formula C27H29F4N5O3 and a molecular weight of 547.55 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propoxy]quinazoline.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propoxy]quinazoline |
|---|---|
| PubChem CID | 10128827 |
| Molecular Formula | C27H29F4N5O3 |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propoxy]quinazoline |
| SMILES | COc1cc2c(Oc3ccc4[nH]c(C)cc4c3F)ncnc2cc1OCCCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H29F4N5O3/c1-17-12-18-20(34-17)4-5-22(25(18)28)39-26-19-13-23(37-2)24(14-21(19)32-16-33-26)38-11-3-6-35-7-9-36(10-8-35)15-27(29,30)31/h4-5,12-14,16,34H,3,6-11,15H2,1-2H3 |
| InChIKey | VEZNTDNGOMLOTM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|