C22H32O5 — CID 101288273
(1R,2R,4S,8R,10R,14R,17S,18R)-14,17-dihydroxy-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one (PubChem CID 101288273) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (1R,2R,4S,8R,10R,14R,17S,18R)-14,17-dihydroxy-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one.
| Compound Name | (1R,2R,4S,8R,10R,14R,17S,18R)-14,17-dihydroxy-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one |
|---|---|
| PubChem CID | 101288273 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1R,2R,4S,8R,10R,14R,17S,18R)-14,17-dihydroxy-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one |
| SMILES | CC1(C)O[C@H]2C[C@@]3(C)[C@@H](C[C@H]2O1)C(=O)C=C1[C@@H]3CC[C@]2(C)[C@@H](O)CC[C@@]12O |
| InChI | InChI=1S/C22H32O5/c1-19(2)26-16-10-14-15(23)9-13-12(20(14,3)11-17(16)27-19)5-7-21(4)18(24)6-8-22(13,21)25/h9,12,14,16-18,24-25H,5-8,10-11H2,1-4H3/t12-,14-,16+,17-,18-,20+,21+,22+/m0/s1 |
| InChIKey | UKXAPKYINCIIBR-QHUVTNQRSA-N |
| XLogP | 2.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |