C20H32O2 — CID 101288369
(1R,7S,8S,8aR)-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-4-methylidene-3a,5,6,7,8,8a-hexahydroazulene-1,8-diol (PubChem CID 101288369) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,7S,8S,8aR)-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-4-methylidene-3a,5,6,7,8,8a-hexahydroazulene-1,8-diol.
| Compound Name | (1R,7S,8S,8aR)-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-4-methylidene-3a,5,6,7,8,8a-hexahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 101288369 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,7S,8S,8aR)-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-4-methylidene-3a,5,6,7,8,8a-hexahydroazulene-1,8-diol |
| SMILES | C=C1CC[C@@H]([C@H](C)CCC=C(C)C)[C@H](O)[C@H]2C1C=C[C@@]2(C)O |
| InChI | InChI=1S/C20H32O2/c1-13(2)7-6-8-14(3)17-10-9-15(4)16-11-12-20(5,22)18(16)19(17)21/h7,11-12,14,16-19,21-22H,4,6,8-10H2,1-3,5H3/t14-,16?,17+,18-,19+,20-/m1/s1 |
| InChIKey | CSSNLWVFCWOUIA-XHCRUWOZSA-N |
| XLogP | 4.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|