C21H40O3Si — CID 101288375
(10Z,13S,14S)-14-pentyl-13-trimethylsilyloxy-1-oxacyclotetradec-10-en-2-one (PubChem CID 101288375) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (10Z,13S,14S)-14-pentyl-13-trimethylsilyloxy-1-oxacyclotetradec-10-en-2-one.
| Compound Name | (10Z,13S,14S)-14-pentyl-13-trimethylsilyloxy-1-oxacyclotetradec-10-en-2-one |
|---|---|
| PubChem CID | 101288375 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (10Z,13S,14S)-14-pentyl-13-trimethylsilyloxy-1-oxacyclotetradec-10-en-2-one |
| SMILES | CCCCC[C@@H]1OC(=O)CCCCCCC/C=C\C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-5-6-13-16-19-20(24-25(2,3)4)17-14-11-9-7-8-10-12-15-18-21(22)23-19/h11,14,19-20H,5-10,12-13,15-18H2,1-4H3/b14-11-/t19-,20-/m0/s1 |
| InChIKey | LRZIWQPYGHKXEX-LGDBWNHCSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|