About (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine
(E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine (PubChem CID 101288981) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine |
| PubChem CID | 101288981 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine |
| SMILES | CC(N)/C=C/N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-14(17)12-13-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,17H2,1H3/b13-12+ |
| InChIKey | JIRIPJUDTMFCLQ-OUKQBFOZSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine?
The IUPAC name of (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine (CID 101288981) is (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine.
What is the SMILES notation for (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine?
The canonical SMILES for (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine is CC(N)/C=C/N(c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine?
The InChIKey is JIRIPJUDTMFCLQ-OUKQBFOZSA-N. The full InChI is InChI=1S/C16H18N2/c1-14(17)12-13-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,17H2,1H3/b13-12+.
What are the key properties of (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine?
(E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine has a molecular weight of 238.33 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N,1-N-diphenylbut-1-ene-1,3-diamine is sourced from PubChem (CID 101288981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).