C22H43NaO4S — CID 101289032
sodium [(E)-2-nonyltridec-3-enyl] sulfate (PubChem CID 101289032) has the molecular formula C22H43NaO4S and a molecular weight of 426.64 g/mol. Its IUPAC name is sodium [(E)-2-nonyltridec-3-enyl] sulfate.
| Compound Name | sodium [(E)-2-nonyltridec-3-enyl] sulfate |
|---|---|
| PubChem CID | 101289032 |
| Molecular Formula | C22H43NaO4S |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | sodium [(E)-2-nonyltridec-3-enyl] sulfate |
| SMILES | CCCCCCCCC/C=C/C(CCCCCCCCC)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H44O4S.Na/c1-3-5-7-9-11-12-14-16-18-20-22(21-26-27(23,24)25)19-17-15-13-10-8-6-4-2;/h18,20,22H,3-17,19,21H2,1-2H3,(H,23,24,25);/q;+1/p-1/b20-18+; |
| InChIKey | BQYJSAXMILHISU-KPJFUTMLSA-M |
| XLogP | 3.92 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|