[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate

C20H40O4S — CID 101289375

IUPAC[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate
SMILESCCCCCCCCCC/C=C/C(CCCCCC)COS(=O)(=O)O
InChIInChI=1S/C20H40O4S/c1-3-5-7-9-10-11-12-13-14-16-18-20(17-15-8-6-4-2)19-24-25(21,22)23/h16,18,20H,3-15,17,19H2,1-2H3,(H,21,22,23)/b18-16+
InChIKeyWMENTYLILYPIMW-FBMGVBCBSA-N
MW376.60 g/mol
LogP6.48
Rot. Bonds18

About [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate

[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate (PubChem CID 101289375) has the molecular formula C20H40O4S and a molecular weight of 376.60 g/mol. Its IUPAC name is [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate.

Molecular Properties

Compound Name[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate
PubChem CID101289375
Molecular FormulaC20H40O4S
Molecular Weight376.60 g/mol
Exact Mass376.26
IUPAC Name[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate
SMILESCCCCCCCCCC/C=C/C(CCCCCC)COS(=O)(=O)O
InChIInChI=1S/C20H40O4S/c1-3-5-7-9-10-11-12-13-14-16-18-20(17-15-8-6-4-2)19-24-25(21,22)23/h16,18,20H,3-15,17,19H2,1-2H3,(H,21,22,23)/b18-16+
InChIKeyWMENTYLILYPIMW-FBMGVBCBSA-N
XLogP6.48
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds18
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.60
LogP ≤ 56.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[(E)-2-tridecylnonadec-3-enyl] hydrogen sulfate
CID 101289239
[(E)-2-tetradecyltricos-3-enyl] hydrogen sulfate
CID 101288533
2-[(E)-hexadec-1-enyl]icosyl hydrogen sulfate
CID 101290670
[(E)-2-octyldocos-3-enyl] hydrogen sulfate
CID 101289011
[(E)-2-hexadecyldocos-3-enyl] hydrogen sulfate
CID 101288589
2-[(E)-octadec-1-enyl]henicosyl hydrogen sulfate
CID 101290694
2-[(E)-heptadec-1-enyl]icosyl hydrogen sulfate
CID 101290682
2-[(E)-tridec-1-enyl]icosyl hydrogen sulfate
CID 101290610
2-[(E)-hept-1-enyl]octadecyl hydrogen sulfate
CID 101290349
[(E)-2-hexadecyltricos-3-enyl] hydrogen sulfate
CID 101288593
2-[(E)-hex-1-enyl]pentadecyl hydrogen sulfate
CID 101290285
2-[(E)-hex-1-enyl]icosyl hydrogen sulfate
CID 101290305

Frequently Asked Questions

What is the IUPAC name of [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate?
The IUPAC name of [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate (CID 101289375) is [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate.
What is the SMILES notation for [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate?
The canonical SMILES for [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate is CCCCCCCCCC/C=C/C(CCCCCC)COS(=O)(=O)O.
What is the InChIKey of [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate?
The InChIKey is WMENTYLILYPIMW-FBMGVBCBSA-N. The full InChI is InChI=1S/C20H40O4S/c1-3-5-7-9-10-11-12-13-14-16-18-20(17-15-8-6-4-2)19-24-25(21,22)23/h16,18,20H,3-15,17,19H2,1-2H3,(H,21,22,23)/b18-16+.
What are the key properties of [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate?
[(E)-2-hexyltetradec-3-enyl] hydrogen sulfate has a molecular weight of 376.60 g/mol, XLogP of 6.48, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-hexyltetradec-3-enyl] hydrogen sulfate is sourced from PubChem (CID 101289375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).