C20H39KO4S — CID 101289434
potassium [(E)-2-heptyltridec-3-enyl] sulfate (PubChem CID 101289434) has the molecular formula C20H39KO4S and a molecular weight of 414.69 g/mol. Its IUPAC name is potassium [(E)-2-heptyltridec-3-enyl] sulfate.
| Compound Name | potassium [(E)-2-heptyltridec-3-enyl] sulfate |
|---|---|
| PubChem CID | 101289434 |
| Molecular Formula | C20H39KO4S |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | potassium [(E)-2-heptyltridec-3-enyl] sulfate |
| SMILES | CCCCCCCCC/C=C/C(CCCCCCC)COS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C20H40O4S.K/c1-3-5-7-9-10-11-12-14-16-18-20(19-24-25(21,22)23)17-15-13-8-6-4-2;/h16,18,20H,3-15,17,19H2,1-2H3,(H,21,22,23);/q;+1/p-1/b18-16+; |
| InChIKey | JFFJMLXTMXPAIB-HYNBPGMHSA-M |
| XLogP | 3.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|