C38H74CaO8S2 — CID 101289489
calcium bis([(E)-2-octylundec-3-enyl] sulfate) (PubChem CID 101289489) has the molecular formula C38H74CaO8S2 and a molecular weight of 763.21 g/mol. Its IUPAC name is calcium bis([(E)-2-octylundec-3-enyl] sulfate).
| Compound Name | calcium bis([(E)-2-octylundec-3-enyl] sulfate) |
|---|---|
| PubChem CID | 101289489 |
| Molecular Formula | C38H74CaO8S2 |
| Molecular Weight | 763.21 g/mol |
| Exact Mass | 762.45 |
| IUPAC Name | calcium bis([(E)-2-octylundec-3-enyl] sulfate) |
| SMILES | CCCCCCC/C=C/C(CCCCCCCC)COS(=O)(=O)[O-].CCCCCCC/C=C/C(CCCCCCCC)COS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C19H38O4S.Ca/c2*1-3-5-7-9-11-13-15-17-19(18-23-24(20,21)22)16-14-12-10-8-6-4-2;/h2*15,17,19H,3-14,16,18H2,1-2H3,(H,20,21,22);/q;;+2/p-2/b2*17-15+; |
| InChIKey | NAHJSIJANMOTJC-RVUOTHGYSA-L |
| XLogP | 11.11 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.21 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|