C20H32O4 — CID 101289581
(2R,3R,4aR,4bS,7R,10aR)-7-ethenyl-1,1-bis(hydroxymethyl)-4a,7-dimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,3-diol (PubChem CID 101289581) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2R,3R,4aR,4bS,7R,10aR)-7-ethenyl-1,1-bis(hydroxymethyl)-4a,7-dimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,3-diol.
| Compound Name | (2R,3R,4aR,4bS,7R,10aR)-7-ethenyl-1,1-bis(hydroxymethyl)-4a,7-dimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 101289581 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2R,3R,4aR,4bS,7R,10aR)-7-ethenyl-1,1-bis(hydroxymethyl)-4a,7-dimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,3-diol |
| SMILES | C=C[C@]1(C)C=C2CC[C@H]3C(CO)(CO)[C@@H](O)[C@H](O)C[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H32O4/c1-4-18(2)8-7-14-13(9-18)5-6-16-19(14,3)10-15(23)17(24)20(16,11-21)12-22/h4,9,14-17,21-24H,1,5-8,10-12H2,2-3H3/t14-,15+,16+,17-,18-,19+/m0/s1 |
| InChIKey | QGUUHNNGZFMSRY-ZOVJDJALSA-N |
| XLogP | 2.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|