C15H18O5 — CID 101290449
2,5-dihydroxy-3-methyl-6-[(1S)-1,2,2-trimethyl-4-oxocyclopentyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 101290449) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2,5-dihydroxy-3-methyl-6-[(1S)-1,2,2-trimethyl-4-oxocyclopentyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-methyl-6-[(1S)-1,2,2-trimethyl-4-oxocyclopentyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101290449 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,5-dihydroxy-3-methyl-6-[(1S)-1,2,2-trimethyl-4-oxocyclopentyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(O)C(=O)C([C@@]2(C)CC(=O)CC2(C)C)=C(O)C1=O |
| InChI | InChI=1S/C15H18O5/c1-7-10(17)12(19)9(13(20)11(7)18)15(4)6-8(16)5-14(15,2)3/h17,20H,5-6H2,1-4H3/t15-/m1/s1 |
| InChIKey | RYHRRJFIOGTROH-OAHLLOKOSA-N |
| XLogP | 2.18 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|