About 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol
2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol (PubChem CID 101290455) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol |
| PubChem CID | 101290455 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol |
| SMILES | C/C=C/C=C/C1CC(O)CCN1 |
| InChI | InChI=1S/C10H17NO/c1-2-3-4-5-9-8-10(12)6-7-11-9/h2-5,9-12H,6-8H2,1H3/b3-2+,5-4+ |
| InChIKey | HUJDEHIXVKEMDT-MQQKCMAXSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol?
The IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol (CID 101290455) is 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol.
What is the SMILES notation for 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol?
The canonical SMILES for 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol is C/C=C/C=C/C1CC(O)CCN1.
What is the InChIKey of 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol?
The InChIKey is HUJDEHIXVKEMDT-MQQKCMAXSA-N. The full InChI is InChI=1S/C10H17NO/c1-2-3-4-5-9-8-10(12)6-7-11-9/h2-5,9-12H,6-8H2,1H3/b3-2+,5-4+.
What are the key properties of 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol?
2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol has a molecular weight of 167.25 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3E)-penta-1,3-dienyl]piperidin-4-ol is sourced from PubChem (CID 101290455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).