C33H52N2O5S — CID 10129125
[(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-(piperidine-2-carbonyl)piperidin-4-yl]sulfanylacetate (PubChem CID 10129125) has the molecular formula C33H52N2O5S and a molecular weight of 588.86 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-(piperidine-2-carbonyl)piperidin-4-yl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-(piperidine-2-carbonyl)piperidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 10129125 |
| Molecular Formula | C33H52N2O5S |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-(piperidine-2-carbonyl)piperidin-4-yl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC2CCN(C(=O)C3CCCCN3)CC2)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C33H52N2O5S/c1-6-31(4)19-26(32(5)21(2)10-14-33(22(3)29(31)38)15-11-25(36)28(32)33)40-27(37)20-41-23-12-17-35(18-13-23)30(39)24-9-7-8-16-34-24/h6,21-24,26,28-29,34,38H,1,7-20H2,2-5H3/t21-,22+,24?,26-,28?,29+,31-,32+,33+/m1/s1 |
| InChIKey | ICGLXBSBFAYFIA-QMMXTLKSSA-N |
| XLogP | 4.76 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|