C19H23KO5S — CID 101292001
potassium 2-(2-heptylphenoxy)-5-sulfophenolate (PubChem CID 101292001) has the molecular formula C19H23KO5S and a molecular weight of 402.55 g/mol. Its IUPAC name is potassium 2-(2-heptylphenoxy)-5-sulfophenolate.
| Compound Name | potassium 2-(2-heptylphenoxy)-5-sulfophenolate |
|---|---|
| PubChem CID | 101292001 |
| Molecular Formula | C19H23KO5S |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | potassium 2-(2-heptylphenoxy)-5-sulfophenolate |
| SMILES | CCCCCCCc1ccccc1Oc1ccc(S(=O)(=O)O)cc1[O-].[K+] |
| InChI | InChI=1S/C19H24O5S.K/c1-2-3-4-5-6-9-15-10-7-8-11-18(15)24-19-13-12-16(14-17(19)20)25(21,22)23;/h7-8,10-14,20H,2-6,9H2,1H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | MRYLYORXJVOWNV-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|