C15H26O3 — CID 101293625
(2R,3R,4S,4aR,8aS)-2-hydroxy-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 101293625) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R,3R,4S,4aR,8aS)-2-hydroxy-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (2R,3R,4S,4aR,8aS)-2-hydroxy-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 101293625 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2R,3R,4S,4aR,8aS)-2-hydroxy-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-3,4,5,6,7,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@H]1[C@@H](O)C(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CO |
| InChI | InChI=1S/C15H26O3/c1-9-10(8-16)15(4)7-5-6-14(2,3)13(15)12(18)11(9)17/h9-11,13,16-17H,5-8H2,1-4H3/t9-,10+,11-,13+,15-/m1/s1 |
| InChIKey | VYPHPGCDLVZOIM-WORPLKMKSA-N |
| XLogP | 2.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |