C22H26O9 — CID 101293642
[(1R,2S,6R,7R,8R,11S,12R,14R)-11-acetyloxy-1,7-dihydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 101293642) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is [(1R,2S,6R,7R,8R,11S,12R,14R)-11-acetyloxy-1,7-dihydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,6R,7R,8R,11S,12R,14R)-11-acetyloxy-1,7-dihydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101293642 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(1R,2S,6R,7R,8R,11S,12R,14R)-11-acetyloxy-1,7-dihydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](O)[C@H](OC(=O)/C(C)=C\C)C(C)=C1[C@H](OC(C)=O)[C@H]3O[C@@]3(C)[C@@]12O |
| InChI | InChI=1S/C22H26O9/c1-7-8(2)19(25)29-15-10(4)13-16(28-11(5)23)18-21(6,31-18)22(13,27)17-12(14(15)24)9(3)20(26)30-17/h7,12,14-18,24,27H,3H2,1-2,4-6H3/b8-7-/t12-,14-,15-,16+,17+,18-,21-,22-/m1/s1 |
| InChIKey | WGZVUXQFHASBJA-NOZUZWHMSA-N |
| XLogP | 0.49 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|