C20H26O5S — CID 101293697
2-hydroxy-3-octyl-4-phenoxybenzenesulfonic acid (PubChem CID 101293697) has the molecular formula C20H26O5S and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-hydroxy-3-octyl-4-phenoxybenzenesulfonic acid.
| Compound Name | 2-hydroxy-3-octyl-4-phenoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 101293697 |
| Molecular Formula | C20H26O5S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-hydroxy-3-octyl-4-phenoxybenzenesulfonic acid |
| SMILES | CCCCCCCCc1c(Oc2ccccc2)ccc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C20H26O5S/c1-2-3-4-5-6-10-13-17-18(25-16-11-8-7-9-12-16)14-15-19(20(17)21)26(22,23)24/h7-9,11-12,14-15,21H,2-6,10,13H2,1H3,(H,22,23,24) |
| InChIKey | RYPNPPOTOGWKGV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|