C21H28O5S — CID 101294227
3-(3-hydroxyphenoxy)-5-nonylbenzenesulfonic acid (PubChem CID 101294227) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-(3-hydroxyphenoxy)-5-nonylbenzenesulfonic acid.
| Compound Name | 3-(3-hydroxyphenoxy)-5-nonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 101294227 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(3-hydroxyphenoxy)-5-nonylbenzenesulfonic acid |
| SMILES | CCCCCCCCCc1cc(Oc2cccc(O)c2)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H28O5S/c1-2-3-4-5-6-7-8-10-17-13-20(16-21(14-17)27(23,24)25)26-19-12-9-11-18(22)15-19/h9,11-16,22H,2-8,10H2,1H3,(H,23,24,25) |
| InChIKey | CEUCSOUHERVQPT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|