About 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane
4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane (PubChem CID 101294737) has the molecular formula C21H42O4
and a molecular weight of 358.56 g/mol. Its IUPAC name is 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane.
Molecular Properties
| Compound Name | 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane |
| PubChem CID | 101294737 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane |
| SMILES | CCCC(C)(CC)OOC1(OOC(C)(CC)CCC)CCC(C)CC1 |
| InChI | InChI=1S/C21H42O4/c1-8-14-19(6,10-3)22-24-21(16-12-18(5)13-17-21)25-23-20(7,11-4)15-9-2/h18H,8-17H2,1-7H3 |
| InChIKey | ODRUYXXLODOFNG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane?
The IUPAC name of 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane (CID 101294737) is 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane.
What is the SMILES notation for 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane?
The canonical SMILES for 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane is CCCC(C)(CC)OOC1(OOC(C)(CC)CCC)CCC(C)CC1.
What is the InChIKey of 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane?
The InChIKey is ODRUYXXLODOFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O4/c1-8-14-19(6,10-3)22-24-21(16-12-18(5)13-17-21)25-23-20(7,11-4)15-9-2/h18H,8-17H2,1-7H3.
What are the key properties of 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane?
4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane has a molecular weight of 358.56 g/mol, XLogP of 6.73, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,1-bis(3-methylhexan-3-ylperoxy)cyclohexane is sourced from PubChem (CID 101294737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).