C22H30O5S — CID 101295078
3-(2-decylphenoxy)-5-hydroxybenzenesulfonic acid (PubChem CID 101295078) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is 3-(2-decylphenoxy)-5-hydroxybenzenesulfonic acid.
| Compound Name | 3-(2-decylphenoxy)-5-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 101295078 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-(2-decylphenoxy)-5-hydroxybenzenesulfonic acid |
| SMILES | CCCCCCCCCCc1ccccc1Oc1cc(O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H30O5S/c1-2-3-4-5-6-7-8-9-12-18-13-10-11-14-22(18)27-20-15-19(23)16-21(17-20)28(24,25)26/h10-11,13-17,23H,2-9,12H2,1H3,(H,24,25,26) |
| InChIKey | HKUMMYKCOJCDSF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|