C22H29KO5S — CID 101295268
potassium 2-decyl-5-(4-sulfophenoxy)phenolate (PubChem CID 101295268) has the molecular formula C22H29KO5S and a molecular weight of 444.63 g/mol. Its IUPAC name is potassium 2-decyl-5-(4-sulfophenoxy)phenolate.
| Compound Name | potassium 2-decyl-5-(4-sulfophenoxy)phenolate |
|---|---|
| PubChem CID | 101295268 |
| Molecular Formula | C22H29KO5S |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | potassium 2-decyl-5-(4-sulfophenoxy)phenolate |
| SMILES | CCCCCCCCCCc1ccc(Oc2ccc(S(=O)(=O)O)cc2)cc1[O-].[K+] |
| InChI | InChI=1S/C22H30O5S.K/c1-2-3-4-5-6-7-8-9-10-18-11-12-20(17-22(18)23)27-19-13-15-21(16-14-19)28(24,25)26;/h11-17,23H,2-10H2,1H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | VEPGUAKFYQWPTM-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|