C41H41ClF3N3O4 — CID 10129548
1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-3-(3,5-dimethoxyphenyl)-1-methylurea (PubChem CID 10129548) has the molecular formula C41H41ClF3N3O4 and a molecular weight of 732.24 g/mol. Its IUPAC name is 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-3-(3,5-dimethoxyphenyl)-1-methylurea.
| Compound Name | 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-3-(3,5-dimethoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 10129548 |
| Molecular Formula | C41H41ClF3N3O4 |
| Molecular Weight | 732.24 g/mol |
| Exact Mass | 731.27 |
| IUPAC Name | 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-3-(3,5-dimethoxyphenyl)-1-methylurea |
| SMILES | COc1cc(NC(=O)N(C)c2cccc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)c2)cc(OC)c1 |
| InChI | InChI=1S/C41H41ClF3N3O4/c1-47(40(49)46-32-23-35(50-2)26-36(24-32)51-3)33-18-11-19-34(25-33)52-22-12-21-48(27-31-17-10-20-38(39(31)42)41(43,44)45)28-37(29-13-6-4-7-14-29)30-15-8-5-9-16-30/h4-11,13-20,23-26,37H,12,21-22,27-28H2,1-3H3,(H,46,49) |
| InChIKey | BGCRHLANJIYMGC-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.24 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|