C20H30O4 — CID 101297671
(1R,2R,4S,6R,7R,10S,12S,14S)-6,15,15-trimethyl-11-methylidene-16-oxapentacyclo[8.5.1.14,7.01,12.04,10]heptadecane-2,6,14-triol (PubChem CID 101297671) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,2R,4S,6R,7R,10S,12S,14S)-6,15,15-trimethyl-11-methylidene-16-oxapentacyclo[8.5.1.14,7.01,12.04,10]heptadecane-2,6,14-triol.
| Compound Name | (1R,2R,4S,6R,7R,10S,12S,14S)-6,15,15-trimethyl-11-methylidene-16-oxapentacyclo[8.5.1.14,7.01,12.04,10]heptadecane-2,6,14-triol |
|---|---|
| PubChem CID | 101297671 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,2R,4S,6R,7R,10S,12S,14S)-6,15,15-trimethyl-11-methylidene-16-oxapentacyclo[8.5.1.14,7.01,12.04,10]heptadecane-2,6,14-triol |
| SMILES | C=C1[C@@H]2C[C@H](O)C(C)(C)[C@]23O[C@]12CC[C@@H]1C[C@]2(C[C@H]3O)C[C@@]1(C)O |
| InChI | InChI=1S/C20H30O4/c1-11-13-7-14(21)16(2,3)20(13)15(22)9-18-8-12(17(4,23)10-18)5-6-19(11,18)24-20/h12-15,21-23H,1,5-10H2,2-4H3/t12-,13+,14+,15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | DQSRNQKRJJISCO-UFNXIUMKSA-N |
| XLogP | 2.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|