C17H16N3NaO6S2 — CID 101297717
sodium N-[(6R,7R)-3-(acetyloxymethyl)-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-pyridin-4-ylsulfanylethanimidate (PubChem CID 101297717) has the molecular formula C17H16N3NaO6S2 and a molecular weight of 445.45 g/mol. Its IUPAC name is sodium N-[(6R,7R)-3-(acetyloxymethyl)-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-pyridin-4-ylsulfanylethanimidate.
| Compound Name | sodium N-[(6R,7R)-3-(acetyloxymethyl)-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-pyridin-4-ylsulfanylethanimidate |
|---|---|
| PubChem CID | 101297717 |
| Molecular Formula | C17H16N3NaO6S2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | sodium N-[(6R,7R)-3-(acetyloxymethyl)-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-pyridin-4-ylsulfanylethanimidate |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](/N=C(\[O-])CSc3ccncc3)[C@H]2SC1.[Na+] |
| InChI | InChI=1S/C17H17N3O6S2.Na/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11;/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25);/q;+1/p-1/t13-,16-;/m1./s1 |
| InChIKey | VGEOUKPOQQEQSX-OALZAMAHSA-M |
| XLogP | -2.88 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|