About 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane
2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane (PubChem CID 101298550) has the molecular formula C11H12Br2O2
and a molecular weight of 336.02 g/mol. Its IUPAC name is 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane.
Molecular Properties
| Compound Name | 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane |
| PubChem CID | 101298550 |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane |
| SMILES | Cc1cc(Br)c(OCC2(C)CO2)cc1Br |
| InChI | InChI=1S/C11H12Br2O2/c1-7-3-9(13)10(4-8(7)12)14-5-11(2)6-15-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | RLBNBYVCUIIZQG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane?
The IUPAC name of 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane (CID 101298550) is 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane.
What is the SMILES notation for 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane?
The canonical SMILES for 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane is Cc1cc(Br)c(OCC2(C)CO2)cc1Br.
What is the InChIKey of 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane?
The InChIKey is RLBNBYVCUIIZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Br2O2/c1-7-3-9(13)10(4-8(7)12)14-5-11(2)6-15-11/h3-4H,5-6H2,1-2H3.
What are the key properties of 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane?
2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane has a molecular weight of 336.02 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dibromo-4-methylphenoxy)methyl]-2-methyloxirane is sourced from PubChem (CID 101298550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).