About 1-ethoxyethanol
1-ethoxyethanol (PubChem CID 10129898) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is 1-ethoxyethanol.
Molecular Properties
| Compound Name | 1-ethoxyethanol |
| PubChem CID | 10129898 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 1-ethoxyethanol |
| SMILES | CCOC(C)O |
| InChI | InChI=1S/C4H10O2/c1-3-6-4(2)5/h4-5H,3H2,1-2H3 |
| InChIKey | CAFAOQIVXSSFSY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethanol?
The IUPAC name of 1-ethoxyethanol (CID 10129898) is 1-ethoxyethanol.
What is the SMILES notation for 1-ethoxyethanol?
The canonical SMILES for 1-ethoxyethanol is CCOC(C)O.
What is the InChIKey of 1-ethoxyethanol?
The InChIKey is CAFAOQIVXSSFSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2/c1-3-6-4(2)5/h4-5H,3H2,1-2H3.
What are the key properties of 1-ethoxyethanol?
1-ethoxyethanol has a molecular weight of 90.12 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethanol is sourced from PubChem (CID 10129898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).