About 5,5-Dimethyl-1,3,2-dioxaborinane
5,5-Dimethyl-1,3,2-dioxaborinane (PubChem CID 10129925) has the molecular formula C5H10BO2
and a molecular weight of 112.94 g/mol.
Molecular Properties
| Compound Name | 5,5-Dimethyl-1,3,2-dioxaborinane |
| PubChem CID | 10129925 |
| Molecular Formula | C5H10BO2 |
| Molecular Weight | 112.94 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | — |
| SMILES | CC1(C)CO[B]OC1 |
| InChI | InChI=1S/C5H10BO2/c1-5(2)3-7-6-8-4-5/h3-4H2,1-2H3 |
| InChIKey | ZOMDNJFVTTXWBX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.94 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-Dimethyl-1,3,2-dioxaborinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-Dimethyl-1,3,2-dioxaborinane?
The IUPAC name of 5,5-Dimethyl-1,3,2-dioxaborinane (CID 10129925) is not available.
What is the SMILES notation for 5,5-Dimethyl-1,3,2-dioxaborinane?
The canonical SMILES for 5,5-Dimethyl-1,3,2-dioxaborinane is CC1(C)CO[B]OC1.
What is the InChIKey of 5,5-Dimethyl-1,3,2-dioxaborinane?
The InChIKey is ZOMDNJFVTTXWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BO2/c1-5(2)3-7-6-8-4-5/h3-4H2,1-2H3.
What are the key properties of 5,5-Dimethyl-1,3,2-dioxaborinane?
5,5-Dimethyl-1,3,2-dioxaborinane has a molecular weight of 112.94 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-Dimethyl-1,3,2-dioxaborinane is sourced from PubChem (CID 10129925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).