About 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol
5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol (PubChem CID 101299521) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol.
Molecular Properties
| Compound Name | 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol |
| PubChem CID | 101299521 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol |
| SMILES | Cc1ccc(C)c(-c2cc(O)c(O)c(C)c2O)c1 |
| InChI | InChI=1S/C15H16O3/c1-8-4-5-9(2)11(6-8)12-7-13(16)15(18)10(3)14(12)17/h4-7,16-18H,1-3H3 |
| InChIKey | DDCHOUHDBWTSNB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol?
The IUPAC name of 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol (CID 101299521) is 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol.
What is the SMILES notation for 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol?
The canonical SMILES for 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol is Cc1ccc(C)c(-c2cc(O)c(O)c(C)c2O)c1.
What is the InChIKey of 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol?
The InChIKey is DDCHOUHDBWTSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3/c1-8-4-5-9(2)11(6-8)12-7-13(16)15(18)10(3)14(12)17/h4-7,16-18H,1-3H3.
What are the key properties of 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol?
5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol has a molecular weight of 244.29 g/mol, XLogP of 3.40, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylphenyl)-3-methylbenzene-1,2,4-triol is sourced from PubChem (CID 101299521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).