About 2-methylhex-4-ynoic acid
2-methylhex-4-ynoic acid (PubChem CID 10129954) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-methylhex-4-ynoic acid.
Molecular Properties
| Compound Name | 2-methylhex-4-ynoic acid |
| PubChem CID | 10129954 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-methylhex-4-ynoic acid |
| SMILES | CC#CCC(C)C(=O)O |
| InChI | InChI=1S/C7H10O2/c1-3-4-5-6(2)7(8)9/h6H,5H2,1-2H3,(H,8,9) |
| InChIKey | YVZVHNPTRCHYEY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-4-ynoic acid?
The IUPAC name of 2-methylhex-4-ynoic acid (CID 10129954) is 2-methylhex-4-ynoic acid.
What is the SMILES notation for 2-methylhex-4-ynoic acid?
The canonical SMILES for 2-methylhex-4-ynoic acid is CC#CCC(C)C(=O)O.
What is the InChIKey of 2-methylhex-4-ynoic acid?
The InChIKey is YVZVHNPTRCHYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-4-5-6(2)7(8)9/h6H,5H2,1-2H3,(H,8,9).
What are the key properties of 2-methylhex-4-ynoic acid?
2-methylhex-4-ynoic acid has a molecular weight of 126.15 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-4-ynoic acid is sourced from PubChem (CID 10129954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).