About (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol
(2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 10129968) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 10129968 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | OC[C@H]1OCC=C[C@@H]1O |
| InChI | InChI=1S/C6H10O3/c7-4-6-5(8)2-1-3-9-6/h1-2,5-8H,3-4H2/t5-,6+/m0/s1 |
| InChIKey | CNTQWODJJQFZLR-NTSWFWBYSA-N |
| XLogP | -0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol (CID 10129968) is (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol is OC[C@H]1OCC=C[C@@H]1O.
What is the InChIKey of (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is CNTQWODJJQFZLR-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H10O3/c7-4-6-5(8)2-1-3-9-6/h1-2,5-8H,3-4H2/t5-,6+/m0/s1.
What are the key properties of (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol?
(2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 130.14 g/mol, XLogP of -0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 10129968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).