About N-hydroxyacetamide;iron(3+)
N-hydroxyacetamide;iron(3+) (PubChem CID 10129970) has the molecular formula C2H5FeNO2+3
and a molecular weight of 130.91 g/mol. Its IUPAC name is N-hydroxyacetamide;iron(3+).
Molecular Properties
| Compound Name | N-hydroxyacetamide;iron(3+) |
| PubChem CID | 10129970 |
| Molecular Formula | C2H5FeNO2+3 |
| Molecular Weight | 130.91 g/mol |
| Exact Mass | 130.97 |
| IUPAC Name | N-hydroxyacetamide;iron(3+) |
| SMILES | CC(=O)NO.[Fe+3] |
| InChI | InChI=1S/C2H5NO2.Fe/c1-2(4)3-5;/h5H,1H3,(H,3,4);/q;+3 |
| InChIKey | SKKWVZURRPXRFO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.91 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyacetamide;iron(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyacetamide;iron(3+)?
The IUPAC name of N-hydroxyacetamide;iron(3+) (CID 10129970) is N-hydroxyacetamide;iron(3+).
What is the SMILES notation for N-hydroxyacetamide;iron(3+)?
The canonical SMILES for N-hydroxyacetamide;iron(3+) is CC(=O)NO.[Fe+3].
What is the InChIKey of N-hydroxyacetamide;iron(3+)?
The InChIKey is SKKWVZURRPXRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.Fe/c1-2(4)3-5;/h5H,1H3,(H,3,4);/q;+3.
What are the key properties of N-hydroxyacetamide;iron(3+)?
N-hydroxyacetamide;iron(3+) has a molecular weight of 130.91 g/mol, XLogP of -0.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyacetamide;iron(3+) is sourced from PubChem (CID 10129970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).