C50H82BaO8 — CID 101300352
barium(2+);bis(4-hydroxy-12-phenylmethoxyoctadecanoate) (PubChem CID 101300352) has the molecular formula C50H82BaO8 and a molecular weight of 948.53 g/mol. Its IUPAC name is barium(2+);bis(4-hydroxy-12-phenylmethoxyoctadecanoate).
| Compound Name | barium(2+);bis(4-hydroxy-12-phenylmethoxyoctadecanoate) |
|---|---|
| PubChem CID | 101300352 |
| Molecular Formula | C50H82BaO8 |
| Molecular Weight | 948.53 g/mol |
| Exact Mass | 948.51 |
| IUPAC Name | barium(2+);bis(4-hydroxy-12-phenylmethoxyoctadecanoate) |
| SMILES | CCCCCCC(CCCCCCCC(O)CCC(=O)[O-])OCc1ccccc1.CCCCCCC(CCCCCCCC(O)CCC(=O)[O-])OCc1ccccc1.[Ba+2] |
| InChI | InChI=1S/2C25H42O4.Ba/c2*1-2-3-4-12-17-24(29-21-22-14-9-8-10-15-22)18-13-7-5-6-11-16-23(26)19-20-25(27)28;/h2*8-10,14-15,23-24,26H,2-7,11-13,16-21H2,1H3,(H,27,28);/q;;+2/p-2 |
| InChIKey | AIBURQSOZCJDSK-UHFFFAOYSA-L |
| XLogP | 9.95 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.53 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|