C5H9N5O — CID 10130075
3,4-diamino-6-ethyl-1,2,4-triazin-5-one (PubChem CID 10130075) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is 3,4-diamino-6-ethyl-1,2,4-triazin-5-one.
| Compound Name | 3,4-diamino-6-ethyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 10130075 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3,4-diamino-6-ethyl-1,2,4-triazin-5-one |
| SMILES | CCc1nnc(N)n(N)c1=O |
| InChI | InChI=1S/C5H9N5O/c1-2-3-4(11)10(7)5(6)9-8-3/h2,7H2,1H3,(H2,6,9) |
| InChIKey | NZUQFUDOBZRUNR-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |