C9H11N3O — CID 10130205
1-phenyl-1,2,4-triazinan-3-one (PubChem CID 10130205) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-phenyl-1,2,4-triazinan-3-one.
| Compound Name | 1-phenyl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 10130205 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1-phenyl-1,2,4-triazinan-3-one |
| SMILES | O=C1NCCN(c2ccccc2)N1 |
| InChI | InChI=1S/C9H11N3O/c13-9-10-6-7-12(11-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11,13) |
| InChIKey | PBAAMDZDOAGGRJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |